C27H23ClF3N — CID 139872731
2-[2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-ethylpyridine (PubChem CID 139872731) has the molecular formula C27H23ClF3N and a molecular weight of 453.94 g/mol. Its IUPAC name is 2-[2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-ethylpyridine.
| Compound Name | 2-[2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-ethylpyridine |
|---|---|
| PubChem CID | 139872731 |
| Molecular Formula | C27H23ClF3N |
| Molecular Weight | 453.94 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-[2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-ethylpyridine |
| SMILES | CCc1ccc(CCc2ccc3c(F)c(CCc4cc(F)c(Cl)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C27H23ClF3N/c1-2-17-4-10-22(32-16-17)11-5-18-6-12-23-21(13-18)9-8-20(27(23)31)7-3-19-14-24(29)26(28)25(30)15-19/h4,6,8-10,12-16H,2-3,5,7,11H2,1H3 |
| InChIKey | BBKRLCOSOVDGGB-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.94 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|