C32H31F6N — CID 139872473
2-[2-[6-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-hexylpyridine (PubChem CID 139872473) has the molecular formula C32H31F6N and a molecular weight of 543.60 g/mol. Its IUPAC name is 2-[2-[6-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-hexylpyridine.
| Compound Name | 2-[2-[6-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-hexylpyridine |
|---|---|
| PubChem CID | 139872473 |
| Molecular Formula | C32H31F6N |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | 2-[2-[6-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-hexylpyridine |
| SMILES | CCCCCCc1ccc(CCc2ccc3c(F)c(CCc4cc(F)c(C(F)(F)F)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C32H31F6N/c1-2-3-4-5-6-22-9-15-26(39-20-22)14-8-21-10-16-27-25(17-21)13-12-24(31(27)35)11-7-23-18-28(33)30(29(34)19-23)32(36,37)38/h9-10,12-13,15-20H,2-8,11,14H2,1H3 |
| InChIKey | JFXUHBCEHVGPMU-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|