C26H21ClF3N — CID 139872572
2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-propylpyridine (PubChem CID 139872572) has the molecular formula C26H21ClF3N and a molecular weight of 439.91 g/mol. Its IUPAC name is 2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-propylpyridine.
| Compound Name | 2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-propylpyridine |
|---|---|
| PubChem CID | 139872572 |
| Molecular Formula | C26H21ClF3N |
| Molecular Weight | 439.91 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-propylpyridine |
| SMILES | CCCc1ccc(-c2ccc3c(F)c(CCc4cc(F)c(Cl)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C26H21ClF3N/c1-2-3-16-5-11-24(31-15-16)20-9-10-21-19(14-20)8-7-18(26(21)30)6-4-17-12-22(28)25(27)23(29)13-17/h5,7-15H,2-4,6H2,1H3 |
| InChIKey | RJNWZVKLOLRTMV-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.91 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|