C27H22ClF3O — CID 139873058
2-[2-(4-chloro-3,5-difluorophenyl)ethyl]-1-fluoro-6-(4-propoxyphenyl)naphthalene (PubChem CID 139873058) has the molecular formula C27H22ClF3O and a molecular weight of 454.92 g/mol. Its IUPAC name is 2-[2-(4-chloro-3,5-difluorophenyl)ethyl]-1-fluoro-6-(4-propoxyphenyl)naphthalene.
| Compound Name | 2-[2-(4-chloro-3,5-difluorophenyl)ethyl]-1-fluoro-6-(4-propoxyphenyl)naphthalene |
|---|---|
| PubChem CID | 139873058 |
| Molecular Formula | C27H22ClF3O |
| Molecular Weight | 454.92 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 2-[2-(4-chloro-3,5-difluorophenyl)ethyl]-1-fluoro-6-(4-propoxyphenyl)naphthalene |
| SMILES | CCCOc1ccc(-c2ccc3c(F)c(CCc4cc(F)c(Cl)c(F)c4)ccc3c2)cc1 |
| InChI | InChI=1S/C27H22ClF3O/c1-2-13-32-22-10-7-18(8-11-22)20-9-12-23-21(16-20)6-5-19(27(23)31)4-3-17-14-24(29)26(28)25(30)15-17/h5-12,14-16H,2-4,13H2,1H3 |
| InChIKey | JGZWDBKJMNYHQJ-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.92 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|