C24H18ClF3N2O — CID 139871361
2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-ethoxypyrimidine (PubChem CID 139871361) has the molecular formula C24H18ClF3N2O and a molecular weight of 442.87 g/mol. Its IUPAC name is 2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-ethoxypyrimidine.
| Compound Name | 2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-ethoxypyrimidine |
|---|---|
| PubChem CID | 139871361 |
| Molecular Formula | C24H18ClF3N2O |
| Molecular Weight | 442.87 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-ethoxypyrimidine |
| SMILES | CCOc1cnc(-c2ccc3c(F)c(CCc4cc(F)c(Cl)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C24H18ClF3N2O/c1-2-31-18-12-29-24(30-13-18)17-7-8-19-16(11-17)6-5-15(23(19)28)4-3-14-9-20(26)22(25)21(27)10-14/h5-13H,2-4H2,1H3 |
| InChIKey | YLNFVJJSAZBPQR-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.87 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|