C26H18ClF5O — CID 139874921
2-[2-(4-chloro-3,5-difluorophenyl)ethyl]-6-(4-ethoxy-2,6-difluorophenyl)-1-fluoronaphthalene (PubChem CID 139874921) has the molecular formula C26H18ClF5O and a molecular weight of 476.87 g/mol. Its IUPAC name is 2-[2-(4-chloro-3,5-difluorophenyl)ethyl]-6-(4-ethoxy-2,6-difluorophenyl)-1-fluoronaphthalene.
| Compound Name | 2-[2-(4-chloro-3,5-difluorophenyl)ethyl]-6-(4-ethoxy-2,6-difluorophenyl)-1-fluoronaphthalene |
|---|---|
| PubChem CID | 139874921 |
| Molecular Formula | C26H18ClF5O |
| Molecular Weight | 476.87 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 2-[2-(4-chloro-3,5-difluorophenyl)ethyl]-6-(4-ethoxy-2,6-difluorophenyl)-1-fluoronaphthalene |
| SMILES | CCOc1cc(F)c(-c2ccc3c(F)c(CCc4cc(F)c(Cl)c(F)c4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C26H18ClF5O/c1-2-33-18-12-20(28)24(21(29)13-18)17-7-8-19-16(11-17)6-5-15(26(19)32)4-3-14-9-22(30)25(27)23(31)10-14/h5-13H,2-4H2,1H3 |
| InChIKey | DHLALGKMFNLHOI-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.87 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|