C25H18ClF3N2O — CID 139873277
2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-prop-2-enoxypyrimidine (PubChem CID 139873277) has the molecular formula C25H18ClF3N2O and a molecular weight of 454.88 g/mol. Its IUPAC name is 2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-prop-2-enoxypyrimidine.
| Compound Name | 2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-prop-2-enoxypyrimidine |
|---|---|
| PubChem CID | 139873277 |
| Molecular Formula | C25H18ClF3N2O |
| Molecular Weight | 454.88 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-prop-2-enoxypyrimidine |
| SMILES | C=CCOc1cnc(-c2ccc3c(F)c(CCc4cc(F)c(Cl)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C25H18ClF3N2O/c1-2-9-32-19-13-30-25(31-14-19)18-7-8-20-17(12-18)6-5-16(24(20)29)4-3-15-10-21(27)23(26)22(28)11-15/h2,5-8,10-14H,1,3-4,9H2 |
| InChIKey | IGJYSFYPQJPGAX-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.88 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|