C26H21ClFNO — CID 139875494
2-[6-[2-(4-chlorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-prop-2-enoxypyridine (PubChem CID 139875494) has the molecular formula C26H21ClFNO and a molecular weight of 417.91 g/mol. Its IUPAC name is 2-[6-[2-(4-chlorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-prop-2-enoxypyridine.
| Compound Name | 2-[6-[2-(4-chlorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-prop-2-enoxypyridine |
|---|---|
| PubChem CID | 139875494 |
| Molecular Formula | C26H21ClFNO |
| Molecular Weight | 417.91 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-[6-[2-(4-chlorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-prop-2-enoxypyridine |
| SMILES | C=CCOc1ccc(-c2ccc3c(F)c(CCc4ccc(Cl)cc4)ccc3c2)nc1 |
| InChI | InChI=1S/C26H21ClFNO/c1-2-15-30-23-12-14-25(29-17-23)21-9-13-24-20(16-21)8-7-19(26(24)28)6-3-18-4-10-22(27)11-5-18/h2,4-5,7-14,16-17H,1,3,6,15H2 |
| InChIKey | JCKGKJQZDBQMNP-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.91 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|