C28H20F6O2 — CID 139870749
2-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethyl]-1-fluoro-6-(4-prop-2-enoxyphenyl)naphthalene (PubChem CID 139870749) has the molecular formula C28H20F6O2 and a molecular weight of 502.45 g/mol. Its IUPAC name is 2-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethyl]-1-fluoro-6-(4-prop-2-enoxyphenyl)naphthalene.
| Compound Name | 2-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethyl]-1-fluoro-6-(4-prop-2-enoxyphenyl)naphthalene |
|---|---|
| PubChem CID | 139870749 |
| Molecular Formula | C28H20F6O2 |
| Molecular Weight | 502.45 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 2-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethyl]-1-fluoro-6-(4-prop-2-enoxyphenyl)naphthalene |
| SMILES | C=CCOc1ccc(-c2ccc3c(F)c(CCc4cc(F)c(OC(F)(F)F)c(F)c4)ccc3c2)cc1 |
| InChI | InChI=1S/C28H20F6O2/c1-2-13-35-22-10-7-18(8-11-22)20-9-12-23-21(16-20)6-5-19(26(23)31)4-3-17-14-24(29)27(25(30)15-17)36-28(32,33)34/h2,5-12,14-16H,1,3-4,13H2 |
| InChIKey | QGFIUTZNIZYFJR-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.45 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|