C31H27F5O2 — CID 139874285
1-fluoro-6-[2-(2-fluoro-4-prop-2-enoxyphenyl)ethyl]-2-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalene (PubChem CID 139874285) has the molecular formula C31H27F5O2 and a molecular weight of 526.55 g/mol. Its IUPAC name is 1-fluoro-6-[2-(2-fluoro-4-prop-2-enoxyphenyl)ethyl]-2-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalene.
| Compound Name | 1-fluoro-6-[2-(2-fluoro-4-prop-2-enoxyphenyl)ethyl]-2-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalene |
|---|---|
| PubChem CID | 139874285 |
| Molecular Formula | C31H27F5O2 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 1-fluoro-6-[2-(2-fluoro-4-prop-2-enoxyphenyl)ethyl]-2-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalene |
| SMILES | C=CCOc1ccc(CCc2ccc3c(F)c(CCc4ccc(OCC(F)(F)F)cc4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C31H27F5O2/c1-2-17-37-27-15-12-23(29(32)19-27)8-4-22-7-16-28-25(18-22)11-10-24(30(28)33)9-3-21-5-13-26(14-6-21)38-20-31(34,35)36/h2,5-7,10-16,18-19H,1,3-4,8-9,17,20H2 |
| InChIKey | YNPNZPRTQIEYPY-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|