C28H21F5O2 — CID 139871625
1-fluoro-2-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]-6-(4-prop-2-enoxyphenyl)naphthalene (PubChem CID 139871625) has the molecular formula C28H21F5O2 and a molecular weight of 484.46 g/mol. Its IUPAC name is 1-fluoro-2-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]-6-(4-prop-2-enoxyphenyl)naphthalene.
| Compound Name | 1-fluoro-2-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]-6-(4-prop-2-enoxyphenyl)naphthalene |
|---|---|
| PubChem CID | 139871625 |
| Molecular Formula | C28H21F5O2 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 1-fluoro-2-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]-6-(4-prop-2-enoxyphenyl)naphthalene |
| SMILES | C=CCOc1ccc(-c2ccc3c(F)c(CCc4ccc(OC(F)(F)F)c(F)c4)ccc3c2)cc1 |
| InChI | InChI=1S/C28H21F5O2/c1-2-15-34-23-11-8-19(9-12-23)21-10-13-24-22(17-21)7-6-20(27(24)30)5-3-18-4-14-26(25(29)16-18)35-28(31,32)33/h2,4,6-14,16-17H,1,3,5,15H2 |
| InChIKey | GXPZXKVFJWKBSW-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|