C29H22F6O — CID 139875498
6-(4-but-3-enyl-2,6-difluorophenyl)-1-fluoro-2-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalene (PubChem CID 139875498) has the molecular formula C29H22F6O and a molecular weight of 500.48 g/mol. Its IUPAC name is 6-(4-but-3-enyl-2,6-difluorophenyl)-1-fluoro-2-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalene.
| Compound Name | 6-(4-but-3-enyl-2,6-difluorophenyl)-1-fluoro-2-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalene |
|---|---|
| PubChem CID | 139875498 |
| Molecular Formula | C29H22F6O |
| Molecular Weight | 500.48 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 6-(4-but-3-enyl-2,6-difluorophenyl)-1-fluoro-2-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalene |
| SMILES | C=CCCc1cc(F)c(-c2ccc3c(F)c(CCc4ccc(OC(F)(F)F)cc4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C29H22F6O/c1-2-3-4-19-15-25(30)27(26(31)16-19)22-11-14-24-21(17-22)10-9-20(28(24)32)8-5-18-6-12-23(13-7-18)36-29(33,34)35/h2,6-7,9-17H,1,3-5,8H2 |
| InChIKey | WKLXDQKXXFPQCA-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.48 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|