C29H22F6 — CID 139873017
6-(4-but-3-enylphenyl)-2-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethyl]-1-fluoronaphthalene (PubChem CID 139873017) has the molecular formula C29H22F6 and a molecular weight of 484.48 g/mol. Its IUPAC name is 6-(4-but-3-enylphenyl)-2-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethyl]-1-fluoronaphthalene.
| Compound Name | 6-(4-but-3-enylphenyl)-2-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethyl]-1-fluoronaphthalene |
|---|---|
| PubChem CID | 139873017 |
| Molecular Formula | C29H22F6 |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 6-(4-but-3-enylphenyl)-2-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethyl]-1-fluoronaphthalene |
| SMILES | C=CCCc1ccc(-c2ccc3c(F)c(CCc4cc(F)c(C(F)(F)F)c(F)c4)ccc3c2)cc1 |
| InChI | InChI=1S/C29H22F6/c1-2-3-4-18-5-8-20(9-6-18)22-13-14-24-23(17-22)12-11-21(28(24)32)10-7-19-15-25(30)27(26(31)16-19)29(33,34)35/h2,5-6,8-9,11-17H,1,3-4,7,10H2 |
| InChIKey | DQOLSNXRJHZXNF-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|