C21H16F4 — CID 139855517
6-(4-but-3-enylphenyl)-1-fluoro-2-(trifluoromethyl)naphthalene (PubChem CID 139855517) has the molecular formula C21H16F4 and a molecular weight of 344.35 g/mol. Its IUPAC name is 6-(4-but-3-enylphenyl)-1-fluoro-2-(trifluoromethyl)naphthalene.
| Compound Name | 6-(4-but-3-enylphenyl)-1-fluoro-2-(trifluoromethyl)naphthalene |
|---|---|
| PubChem CID | 139855517 |
| Molecular Formula | C21H16F4 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 6-(4-but-3-enylphenyl)-1-fluoro-2-(trifluoromethyl)naphthalene |
| SMILES | C=CCCc1ccc(-c2ccc3c(F)c(C(F)(F)F)ccc3c2)cc1 |
| InChI | InChI=1S/C21H16F4/c1-2-3-4-14-5-7-15(8-6-14)16-9-11-18-17(13-16)10-12-19(20(18)22)21(23,24)25/h2,5-13H,1,3-4H2 |
| InChIKey | OXADLYULHVMYCB-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|