C21H16FN — CID 139817636
6-(4-but-3-enylphenyl)-1-fluoronaphthalene-2-carbonitrile (PubChem CID 139817636) has the molecular formula C21H16FN and a molecular weight of 301.36 g/mol. Its IUPAC name is 6-(4-but-3-enylphenyl)-1-fluoronaphthalene-2-carbonitrile.
| Compound Name | 6-(4-but-3-enylphenyl)-1-fluoronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 139817636 |
| Molecular Formula | C21H16FN |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 6-(4-but-3-enylphenyl)-1-fluoronaphthalene-2-carbonitrile |
| SMILES | C=CCCc1ccc(-c2ccc3c(F)c(C#N)ccc3c2)cc1 |
| InChI | InChI=1S/C21H16FN/c1-2-3-4-15-5-7-16(8-6-15)17-11-12-20-18(13-17)9-10-19(14-23)21(20)22/h2,5-13H,1,3-4H2 |
| InChIKey | QNZCEADSSHXDAP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|