C31H23F2N — CID 139850973
4-[2-[6-[2-(4-but-3-enylphenyl)ethyl]-1-fluoronaphthalen-2-yl]ethynyl]-2-fluorobenzonitrile (PubChem CID 139850973) has the molecular formula C31H23F2N and a molecular weight of 447.53 g/mol. Its IUPAC name is 4-[2-[6-[2-(4-but-3-enylphenyl)ethyl]-1-fluoronaphthalen-2-yl]ethynyl]-2-fluorobenzonitrile.
| Compound Name | 4-[2-[6-[2-(4-but-3-enylphenyl)ethyl]-1-fluoronaphthalen-2-yl]ethynyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 139850973 |
| Molecular Formula | C31H23F2N |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 4-[2-[6-[2-(4-but-3-enylphenyl)ethyl]-1-fluoronaphthalen-2-yl]ethynyl]-2-fluorobenzonitrile |
| SMILES | C=CCCc1ccc(CCc2ccc3c(F)c(C#Cc4ccc(C#N)c(F)c4)ccc3c2)cc1 |
| InChI | InChI=1S/C31H23F2N/c1-2-3-4-22-5-7-23(8-6-22)9-10-24-13-18-29-27(19-24)17-16-26(31(29)33)14-11-25-12-15-28(21-34)30(32)20-25/h2,5-8,12-13,15-20H,1,3-4,9-10H2 |
| InChIKey | CIZATFYKMSMRLB-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|