C31H18F6 — CID 139850659
6-[2-(4-but-3-enylphenyl)ethynyl]-2-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethynyl]-1-fluoronaphthalene (PubChem CID 139850659) has the molecular formula C31H18F6 and a molecular weight of 504.47 g/mol. Its IUPAC name is 6-[2-(4-but-3-enylphenyl)ethynyl]-2-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethynyl]-1-fluoronaphthalene.
| Compound Name | 6-[2-(4-but-3-enylphenyl)ethynyl]-2-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethynyl]-1-fluoronaphthalene |
|---|---|
| PubChem CID | 139850659 |
| Molecular Formula | C31H18F6 |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | 6-[2-(4-but-3-enylphenyl)ethynyl]-2-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethynyl]-1-fluoronaphthalene |
| SMILES | C=CCCc1ccc(C#Cc2ccc3c(F)c(C#Cc4cc(F)c(C(F)(F)F)c(F)c4)ccc3c2)cc1 |
| InChI | InChI=1S/C31H18F6/c1-2-3-4-20-5-7-21(8-6-20)9-10-22-12-16-26-25(17-22)15-14-24(30(26)34)13-11-23-18-27(32)29(28(33)19-23)31(35,36)37/h2,5-8,12,14-19H,1,3-4H2 |
| InChIKey | VWHTYAOSVYTNEG-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|