C30H22F4O — CID 139850829
6-(4-but-3-enylphenyl)-1-fluoro-2-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethynyl]naphthalene (PubChem CID 139850829) has the molecular formula C30H22F4O and a molecular weight of 474.50 g/mol. Its IUPAC name is 6-(4-but-3-enylphenyl)-1-fluoro-2-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethynyl]naphthalene.
| Compound Name | 6-(4-but-3-enylphenyl)-1-fluoro-2-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethynyl]naphthalene |
|---|---|
| PubChem CID | 139850829 |
| Molecular Formula | C30H22F4O |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 6-(4-but-3-enylphenyl)-1-fluoro-2-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethynyl]naphthalene |
| SMILES | C=CCCc1ccc(-c2ccc3c(F)c(C#Cc4ccc(OCC(F)(F)F)cc4)ccc3c2)cc1 |
| InChI | InChI=1S/C30H22F4O/c1-2-3-4-21-5-10-23(11-6-21)25-15-18-28-26(19-25)14-13-24(29(28)31)12-7-22-8-16-27(17-9-22)35-20-30(32,33)34/h2,5-6,8-11,13-19H,1,3-4,20H2 |
| InChIKey | IHKAKNKKPWKGFK-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|