C30H25F5O — CID 139872752
6-(4-but-3-enyl-2-fluorophenyl)-1-fluoro-2-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalene (PubChem CID 139872752) has the molecular formula C30H25F5O and a molecular weight of 496.52 g/mol. Its IUPAC name is 6-(4-but-3-enyl-2-fluorophenyl)-1-fluoro-2-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalene.
| Compound Name | 6-(4-but-3-enyl-2-fluorophenyl)-1-fluoro-2-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalene |
|---|---|
| PubChem CID | 139872752 |
| Molecular Formula | C30H25F5O |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 6-(4-but-3-enyl-2-fluorophenyl)-1-fluoro-2-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalene |
| SMILES | C=CCCc1ccc(-c2ccc3c(F)c(CCc4ccc(OCC(F)(F)F)cc4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C30H25F5O/c1-2-3-4-21-8-15-26(28(31)17-21)23-12-16-27-24(18-23)11-10-22(29(27)32)9-5-20-6-13-25(14-7-20)36-19-30(33,34)35/h2,6-8,10-18H,1,3-5,9,19H2 |
| InChIKey | SUGNEOZTWDMPGT-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|