C28H22F4O2 — CID 139874566
2-[2-[4-(difluoromethoxy)phenyl]ethyl]-1-fluoro-6-(2-fluoro-4-prop-2-enoxyphenyl)naphthalene (PubChem CID 139874566) has the molecular formula C28H22F4O2 and a molecular weight of 466.47 g/mol. Its IUPAC name is 2-[2-[4-(difluoromethoxy)phenyl]ethyl]-1-fluoro-6-(2-fluoro-4-prop-2-enoxyphenyl)naphthalene.
| Compound Name | 2-[2-[4-(difluoromethoxy)phenyl]ethyl]-1-fluoro-6-(2-fluoro-4-prop-2-enoxyphenyl)naphthalene |
|---|---|
| PubChem CID | 139874566 |
| Molecular Formula | C28H22F4O2 |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 2-[2-[4-(difluoromethoxy)phenyl]ethyl]-1-fluoro-6-(2-fluoro-4-prop-2-enoxyphenyl)naphthalene |
| SMILES | C=CCOc1ccc(-c2ccc3c(F)c(CCc4ccc(OC(F)F)cc4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C28H22F4O2/c1-2-15-33-23-12-14-24(26(29)17-23)20-9-13-25-21(16-20)8-7-19(27(25)30)6-3-18-4-10-22(11-5-18)34-28(31)32/h2,4-5,7-14,16-17,28H,1,3,6,15H2 |
| InChIKey | VWVYJHNYNOPSBX-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|