C31H30F4O2 — CID 139872286
2-[2-[4-(difluoromethoxy)phenyl]ethyl]-1-fluoro-6-(2-fluoro-4-hexoxyphenyl)naphthalene (PubChem CID 139872286) has the molecular formula C31H30F4O2 and a molecular weight of 510.57 g/mol. Its IUPAC name is 2-[2-[4-(difluoromethoxy)phenyl]ethyl]-1-fluoro-6-(2-fluoro-4-hexoxyphenyl)naphthalene.
| Compound Name | 2-[2-[4-(difluoromethoxy)phenyl]ethyl]-1-fluoro-6-(2-fluoro-4-hexoxyphenyl)naphthalene |
|---|---|
| PubChem CID | 139872286 |
| Molecular Formula | C31H30F4O2 |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 2-[2-[4-(difluoromethoxy)phenyl]ethyl]-1-fluoro-6-(2-fluoro-4-hexoxyphenyl)naphthalene |
| SMILES | CCCCCCOc1ccc(-c2ccc3c(F)c(CCc4ccc(OC(F)F)cc4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C31H30F4O2/c1-2-3-4-5-18-36-26-15-17-27(29(32)20-26)23-12-16-28-24(19-23)11-10-22(30(28)33)9-6-21-7-13-25(14-8-21)37-31(34)35/h7-8,10-17,19-20,31H,2-6,9,18H2,1H3 |
| InChIKey | IAVSZPVZKUILQX-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|