C32H31F5O — CID 139873860
6-(2,6-difluoro-4-heptylphenyl)-2-[2-[4-(difluoromethoxy)phenyl]ethyl]-1-fluoronaphthalene (PubChem CID 139873860) has the molecular formula C32H31F5O and a molecular weight of 526.59 g/mol. Its IUPAC name is 6-(2,6-difluoro-4-heptylphenyl)-2-[2-[4-(difluoromethoxy)phenyl]ethyl]-1-fluoronaphthalene.
| Compound Name | 6-(2,6-difluoro-4-heptylphenyl)-2-[2-[4-(difluoromethoxy)phenyl]ethyl]-1-fluoronaphthalene |
|---|---|
| PubChem CID | 139873860 |
| Molecular Formula | C32H31F5O |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 6-(2,6-difluoro-4-heptylphenyl)-2-[2-[4-(difluoromethoxy)phenyl]ethyl]-1-fluoronaphthalene |
| SMILES | CCCCCCCc1cc(F)c(-c2ccc3c(F)c(CCc4ccc(OC(F)F)cc4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C32H31F5O/c1-2-3-4-5-6-7-22-18-28(33)30(29(34)19-22)25-14-17-27-24(20-25)13-12-23(31(27)35)11-8-21-9-15-26(16-10-21)38-32(36)37/h9-10,12-20,32H,2-8,11H2,1H3 |
| InChIKey | IWYZFCKKQFMEPB-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|