C31H29F5O2 — CID 139873719
6-[2-(4-butoxyphenyl)ethyl]-2-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethyl]-1-fluoronaphthalene (PubChem CID 139873719) has the molecular formula C31H29F5O2 and a molecular weight of 528.56 g/mol. Its IUPAC name is 6-[2-(4-butoxyphenyl)ethyl]-2-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethyl]-1-fluoronaphthalene.
| Compound Name | 6-[2-(4-butoxyphenyl)ethyl]-2-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethyl]-1-fluoronaphthalene |
|---|---|
| PubChem CID | 139873719 |
| Molecular Formula | C31H29F5O2 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 6-[2-(4-butoxyphenyl)ethyl]-2-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethyl]-1-fluoronaphthalene |
| SMILES | CCCCOc1ccc(CCc2ccc3c(F)c(CCc4cc(F)c(OC(F)F)c(F)c4)ccc3c2)cc1 |
| InChI | InChI=1S/C31H29F5O2/c1-2-3-16-37-25-13-7-20(8-14-25)4-5-21-9-15-26-24(17-21)12-11-23(29(26)34)10-6-22-18-27(32)30(28(33)19-22)38-31(35)36/h7-9,11-15,17-19,31H,2-6,10,16H2,1H3 |
| InChIKey | DXAASINZYHBMSR-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|