C32H31F5O2 — CID 139872394
2-[2-[4-(difluoromethoxy)phenyl]ethyl]-6-[2-(2,6-difluoro-4-pentoxyphenyl)ethyl]-1-fluoronaphthalene (PubChem CID 139872394) has the molecular formula C32H31F5O2 and a molecular weight of 542.59 g/mol. Its IUPAC name is 2-[2-[4-(difluoromethoxy)phenyl]ethyl]-6-[2-(2,6-difluoro-4-pentoxyphenyl)ethyl]-1-fluoronaphthalene.
| Compound Name | 2-[2-[4-(difluoromethoxy)phenyl]ethyl]-6-[2-(2,6-difluoro-4-pentoxyphenyl)ethyl]-1-fluoronaphthalene |
|---|---|
| PubChem CID | 139872394 |
| Molecular Formula | C32H31F5O2 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | 2-[2-[4-(difluoromethoxy)phenyl]ethyl]-6-[2-(2,6-difluoro-4-pentoxyphenyl)ethyl]-1-fluoronaphthalene |
| SMILES | CCCCCOc1cc(F)c(CCc2ccc3c(F)c(CCc4ccc(OC(F)F)cc4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C32H31F5O2/c1-2-3-4-17-38-26-19-29(33)28(30(34)20-26)16-9-22-8-15-27-24(18-22)12-11-23(31(27)35)10-5-21-6-13-25(14-7-21)39-32(36)37/h6-8,11-15,18-20,32H,2-5,9-10,16-17H2,1H3 |
| InChIKey | PPTOGBCSUFPIHG-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|