C31H28F6O2 — CID 139870950
6-(2,6-difluoro-4-hexoxyphenyl)-2-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-1-fluoronaphthalene (PubChem CID 139870950) has the molecular formula C31H28F6O2 and a molecular weight of 546.55 g/mol. Its IUPAC name is 6-(2,6-difluoro-4-hexoxyphenyl)-2-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-1-fluoronaphthalene.
| Compound Name | 6-(2,6-difluoro-4-hexoxyphenyl)-2-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-1-fluoronaphthalene |
|---|---|
| PubChem CID | 139870950 |
| Molecular Formula | C31H28F6O2 |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | 6-(2,6-difluoro-4-hexoxyphenyl)-2-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-1-fluoronaphthalene |
| SMILES | CCCCCCOc1cc(F)c(-c2ccc3c(F)c(CCc4ccc(OC(F)F)c(F)c4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C31H28F6O2/c1-2-3-4-5-14-38-23-17-26(33)29(27(34)18-23)22-11-12-24-21(16-22)10-9-20(30(24)35)8-6-19-7-13-28(25(32)15-19)39-31(36)37/h7,9-13,15-18,31H,2-6,8,14H2,1H3 |
| InChIKey | AKWDQCIQHLFXQU-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|