C34H34F6O — CID 139872902
6-[2-(2,6-difluoro-4-heptylphenyl)ethyl]-2-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-1-fluoronaphthalene (PubChem CID 139872902) has the molecular formula C34H34F6O and a molecular weight of 572.63 g/mol. Its IUPAC name is 6-[2-(2,6-difluoro-4-heptylphenyl)ethyl]-2-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-1-fluoronaphthalene.
| Compound Name | 6-[2-(2,6-difluoro-4-heptylphenyl)ethyl]-2-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-1-fluoronaphthalene |
|---|---|
| PubChem CID | 139872902 |
| Molecular Formula | C34H34F6O |
| Molecular Weight | 572.63 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | 6-[2-(2,6-difluoro-4-heptylphenyl)ethyl]-2-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-1-fluoronaphthalene |
| SMILES | CCCCCCCc1cc(F)c(CCc2ccc3c(F)c(CCc4ccc(OC(F)F)c(F)c4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C34H34F6O/c1-2-3-4-5-6-7-24-20-29(35)28(30(36)21-24)16-10-22-9-15-27-26(18-22)14-13-25(33(27)38)12-8-23-11-17-32(31(37)19-23)41-34(39)40/h9,11,13-15,17-21,34H,2-8,10,12,16H2,1H3 |
| InChIKey | VYGJAFAPVPQKFZ-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.63 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|