C33H32F6O — CID 139871047
6-[2-(2,6-difluoro-4-hexylphenyl)ethyl]-1-fluoro-2-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalene (PubChem CID 139871047) has the molecular formula C33H32F6O and a molecular weight of 558.61 g/mol. Its IUPAC name is 6-[2-(2,6-difluoro-4-hexylphenyl)ethyl]-1-fluoro-2-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalene.
| Compound Name | 6-[2-(2,6-difluoro-4-hexylphenyl)ethyl]-1-fluoro-2-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalene |
|---|---|
| PubChem CID | 139871047 |
| Molecular Formula | C33H32F6O |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | 6-[2-(2,6-difluoro-4-hexylphenyl)ethyl]-1-fluoro-2-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalene |
| SMILES | CCCCCCc1cc(F)c(CCc2ccc3c(F)c(CCc4ccc(OC(F)(F)F)cc4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C33H32F6O/c1-2-3-4-5-6-24-20-30(34)29(31(35)21-24)18-11-23-10-17-28-26(19-23)14-13-25(32(28)36)12-7-22-8-15-27(16-9-22)40-33(37,38)39/h8-10,13-17,19-21H,2-7,11-12,18H2,1H3 |
| InChIKey | VUQPTKWRFDXNQD-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|