C30H28F4O2 — CID 139873720
1-fluoro-6-(4-pentoxyphenyl)-2-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalene (PubChem CID 139873720) has the molecular formula C30H28F4O2 and a molecular weight of 496.54 g/mol. Its IUPAC name is 1-fluoro-6-(4-pentoxyphenyl)-2-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalene.
| Compound Name | 1-fluoro-6-(4-pentoxyphenyl)-2-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalene |
|---|---|
| PubChem CID | 139873720 |
| Molecular Formula | C30H28F4O2 |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 1-fluoro-6-(4-pentoxyphenyl)-2-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalene |
| SMILES | CCCCCOc1ccc(-c2ccc3c(F)c(CCc4ccc(OC(F)(F)F)cc4)ccc3c2)cc1 |
| InChI | InChI=1S/C30H28F4O2/c1-2-3-4-19-35-26-16-11-22(12-17-26)24-13-18-28-25(20-24)10-9-23(29(28)31)8-5-21-6-14-27(15-7-21)36-30(32,33)34/h6-7,9-18,20H,2-5,8,19H2,1H3 |
| InChIKey | KWCOZIRTHBNWAH-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|