C30H28F4O — CID 139874209
1-fluoro-6-(4-pentoxyphenyl)-2-[2-[4-(trifluoromethyl)phenyl]ethyl]naphthalene (PubChem CID 139874209) has the molecular formula C30H28F4O and a molecular weight of 480.55 g/mol. Its IUPAC name is 1-fluoro-6-(4-pentoxyphenyl)-2-[2-[4-(trifluoromethyl)phenyl]ethyl]naphthalene.
| Compound Name | 1-fluoro-6-(4-pentoxyphenyl)-2-[2-[4-(trifluoromethyl)phenyl]ethyl]naphthalene |
|---|---|
| PubChem CID | 139874209 |
| Molecular Formula | C30H28F4O |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 1-fluoro-6-(4-pentoxyphenyl)-2-[2-[4-(trifluoromethyl)phenyl]ethyl]naphthalene |
| SMILES | CCCCCOc1ccc(-c2ccc3c(F)c(CCc4ccc(C(F)(F)F)cc4)ccc3c2)cc1 |
| InChI | InChI=1S/C30H28F4O/c1-2-3-4-19-35-27-16-11-22(12-17-27)24-13-18-28-25(20-24)10-9-23(29(28)31)8-5-21-6-14-26(15-7-21)30(32,33)34/h6-7,9-18,20H,2-5,8,19H2,1H3 |
| InChIKey | YQAAQSHUNWQOQE-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|