C27H22F4O — CID 139875416
6-(4-ethoxyphenyl)-1-fluoro-2-[2-[4-(trifluoromethyl)phenyl]ethyl]naphthalene (PubChem CID 139875416) has the molecular formula C27H22F4O and a molecular weight of 438.46 g/mol. Its IUPAC name is 6-(4-ethoxyphenyl)-1-fluoro-2-[2-[4-(trifluoromethyl)phenyl]ethyl]naphthalene.
| Compound Name | 6-(4-ethoxyphenyl)-1-fluoro-2-[2-[4-(trifluoromethyl)phenyl]ethyl]naphthalene |
|---|---|
| PubChem CID | 139875416 |
| Molecular Formula | C27H22F4O |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 6-(4-ethoxyphenyl)-1-fluoro-2-[2-[4-(trifluoromethyl)phenyl]ethyl]naphthalene |
| SMILES | CCOc1ccc(-c2ccc3c(F)c(CCc4ccc(C(F)(F)F)cc4)ccc3c2)cc1 |
| InChI | InChI=1S/C27H22F4O/c1-2-32-24-14-9-19(10-15-24)21-11-16-25-22(17-21)8-7-20(26(25)28)6-3-18-4-12-23(13-5-18)27(29,30)31/h4-5,7-17H,2-3,6H2,1H3 |
| InChIKey | UQXKOZGLNPXOCC-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |