C27H21F5O — CID 139873619
6-(4-ethyl-2-fluorophenyl)-1-fluoro-2-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalene (PubChem CID 139873619) has the molecular formula C27H21F5O and a molecular weight of 456.45 g/mol. Its IUPAC name is 6-(4-ethyl-2-fluorophenyl)-1-fluoro-2-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalene.
| Compound Name | 6-(4-ethyl-2-fluorophenyl)-1-fluoro-2-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalene |
|---|---|
| PubChem CID | 139873619 |
| Molecular Formula | C27H21F5O |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 6-(4-ethyl-2-fluorophenyl)-1-fluoro-2-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalene |
| SMILES | CCc1ccc(-c2ccc3c(F)c(CCc4ccc(OC(F)(F)F)cc4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C27H21F5O/c1-2-17-6-13-23(25(28)15-17)20-10-14-24-21(16-20)9-8-19(26(24)29)7-3-18-4-11-22(12-5-18)33-27(30,31)32/h4-6,8-16H,2-3,7H2,1H3 |
| InChIKey | SDGMKOUTTPNADI-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |