C33H32F6O — CID 139871404
6-[2-(2,6-difluoro-4-heptoxyphenyl)ethyl]-1-fluoro-2-[2-(3,4,5-trifluorophenyl)ethyl]naphthalene (PubChem CID 139871404) has the molecular formula C33H32F6O and a molecular weight of 558.61 g/mol. Its IUPAC name is 6-[2-(2,6-difluoro-4-heptoxyphenyl)ethyl]-1-fluoro-2-[2-(3,4,5-trifluorophenyl)ethyl]naphthalene.
| Compound Name | 6-[2-(2,6-difluoro-4-heptoxyphenyl)ethyl]-1-fluoro-2-[2-(3,4,5-trifluorophenyl)ethyl]naphthalene |
|---|---|
| PubChem CID | 139871404 |
| Molecular Formula | C33H32F6O |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | 6-[2-(2,6-difluoro-4-heptoxyphenyl)ethyl]-1-fluoro-2-[2-(3,4,5-trifluorophenyl)ethyl]naphthalene |
| SMILES | CCCCCCCOc1cc(F)c(CCc2ccc3c(F)c(CCc4cc(F)c(F)c(F)c4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C33H32F6O/c1-2-3-4-5-6-15-40-25-19-28(34)27(29(35)20-25)14-9-21-8-13-26-24(16-21)12-11-23(32(26)38)10-7-22-17-30(36)33(39)31(37)18-22/h8,11-13,16-20H,2-7,9-10,14-15H2,1H3 |
| InChIKey | RXSVAVJOVGBTRC-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|