C24H22F6O — CID 139855620
2-(difluoromethoxy)-6-[2-(2,6-difluoro-4-pentylphenyl)ethyl]-1,3-difluoronaphthalene (PubChem CID 139855620) has the molecular formula C24H22F6O and a molecular weight of 440.43 g/mol. Its IUPAC name is 2-(difluoromethoxy)-6-[2-(2,6-difluoro-4-pentylphenyl)ethyl]-1,3-difluoronaphthalene.
| Compound Name | 2-(difluoromethoxy)-6-[2-(2,6-difluoro-4-pentylphenyl)ethyl]-1,3-difluoronaphthalene |
|---|---|
| PubChem CID | 139855620 |
| Molecular Formula | C24H22F6O |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2-(difluoromethoxy)-6-[2-(2,6-difluoro-4-pentylphenyl)ethyl]-1,3-difluoronaphthalene |
| SMILES | CCCCCc1cc(F)c(CCc2ccc3c(F)c(OC(F)F)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C24H22F6O/c1-2-3-4-5-15-11-19(25)18(20(26)12-15)9-7-14-6-8-17-16(10-14)13-21(27)23(22(17)28)31-24(29)30/h6,8,10-13,24H,2-5,7,9H2,1H3 |
| InChIKey | SXIMXXKGYHFQQP-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|