C27H26F6 — CID 139855835
2-(2,2-difluoroethenyl)-6-[2-(2,6-difluoro-4-heptylphenyl)ethyl]-1,3-difluoronaphthalene (PubChem CID 139855835) has the molecular formula C27H26F6 and a molecular weight of 464.49 g/mol. Its IUPAC name is 2-(2,2-difluoroethenyl)-6-[2-(2,6-difluoro-4-heptylphenyl)ethyl]-1,3-difluoronaphthalene.
| Compound Name | 2-(2,2-difluoroethenyl)-6-[2-(2,6-difluoro-4-heptylphenyl)ethyl]-1,3-difluoronaphthalene |
|---|---|
| PubChem CID | 139855835 |
| Molecular Formula | C27H26F6 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 2-(2,2-difluoroethenyl)-6-[2-(2,6-difluoro-4-heptylphenyl)ethyl]-1,3-difluoronaphthalene |
| SMILES | CCCCCCCc1cc(F)c(CCc2ccc3c(F)c(C=C(F)F)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C27H26F6/c1-2-3-4-5-6-7-18-13-23(28)21(24(29)14-18)11-9-17-8-10-20-19(12-17)15-25(30)22(27(20)33)16-26(31)32/h8,10,12-16H,2-7,9,11H2,1H3 |
| InChIKey | CSPRJQXTZNHPFS-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|