C22H15F5 — CID 139856030
6-(4-but-3-enyl-2-fluorophenyl)-2-(2,2-difluoroethenyl)-1,3-difluoronaphthalene (PubChem CID 139856030) has the molecular formula C22H15F5 and a molecular weight of 374.35 g/mol. Its IUPAC name is 6-(4-but-3-enyl-2-fluorophenyl)-2-(2,2-difluoroethenyl)-1,3-difluoronaphthalene.
| Compound Name | 6-(4-but-3-enyl-2-fluorophenyl)-2-(2,2-difluoroethenyl)-1,3-difluoronaphthalene |
|---|---|
| PubChem CID | 139856030 |
| Molecular Formula | C22H15F5 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 6-(4-but-3-enyl-2-fluorophenyl)-2-(2,2-difluoroethenyl)-1,3-difluoronaphthalene |
| SMILES | C=CCCc1ccc(-c2ccc3c(F)c(C=C(F)F)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C22H15F5/c1-2-3-4-13-5-7-16(19(23)9-13)14-6-8-17-15(10-14)11-20(24)18(22(17)27)12-21(25)26/h2,5-12H,1,3-4H2 |
| InChIKey | GSKATJDXDWUFQM-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|