C29H21F7 — CID 139855817
2-(2,2-difluoroethenyl)-6-[2,6-difluoro-4-(2-fluoro-4-pentylphenyl)phenyl]-1,3-difluoronaphthalene (PubChem CID 139855817) has the molecular formula C29H21F7 and a molecular weight of 502.47 g/mol. Its IUPAC name is 2-(2,2-difluoroethenyl)-6-[2,6-difluoro-4-(2-fluoro-4-pentylphenyl)phenyl]-1,3-difluoronaphthalene.
| Compound Name | 2-(2,2-difluoroethenyl)-6-[2,6-difluoro-4-(2-fluoro-4-pentylphenyl)phenyl]-1,3-difluoronaphthalene |
|---|---|
| PubChem CID | 139855817 |
| Molecular Formula | C29H21F7 |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 2-(2,2-difluoroethenyl)-6-[2,6-difluoro-4-(2-fluoro-4-pentylphenyl)phenyl]-1,3-difluoronaphthalene |
| SMILES | CCCCCc1ccc(-c2cc(F)c(-c3ccc4c(F)c(C=C(F)F)c(F)cc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C29H21F7/c1-2-3-4-5-16-6-8-20(23(30)10-16)19-13-25(32)28(26(33)14-19)17-7-9-21-18(11-17)12-24(31)22(29(21)36)15-27(34)35/h6-15H,2-5H2,1H3 |
| InChIKey | QSPFLAVMLVYVBR-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|