C23H17F7 — CID 139855232
2-(2,2-difluoroethenyl)-6-(2,6-difluoro-4-pentylphenyl)-1,3,8-trifluoronaphthalene (PubChem CID 139855232) has the molecular formula C23H17F7 and a molecular weight of 426.38 g/mol. Its IUPAC name is 2-(2,2-difluoroethenyl)-6-(2,6-difluoro-4-pentylphenyl)-1,3,8-trifluoronaphthalene.
| Compound Name | 2-(2,2-difluoroethenyl)-6-(2,6-difluoro-4-pentylphenyl)-1,3,8-trifluoronaphthalene |
|---|---|
| PubChem CID | 139855232 |
| Molecular Formula | C23H17F7 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2-(2,2-difluoroethenyl)-6-(2,6-difluoro-4-pentylphenyl)-1,3,8-trifluoronaphthalene |
| SMILES | CCCCCc1cc(F)c(-c2cc(F)c3c(F)c(C=C(F)F)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C23H17F7/c1-2-3-4-5-12-6-17(25)21(18(26)7-12)13-8-14-9-16(24)15(11-20(28)29)23(30)22(14)19(27)10-13/h6-11H,2-5H2,1H3 |
| InChIKey | CQKZVQBJQPVSLI-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|