C20H14F6 — CID 139847349
6-(4-butyl-2,6-difluorophenyl)-1,2,3,8-tetrafluoronaphthalene (PubChem CID 139847349) has the molecular formula C20H14F6 and a molecular weight of 368.32 g/mol. Its IUPAC name is 6-(4-butyl-2,6-difluorophenyl)-1,2,3,8-tetrafluoronaphthalene.
| Compound Name | 6-(4-butyl-2,6-difluorophenyl)-1,2,3,8-tetrafluoronaphthalene |
|---|---|
| PubChem CID | 139847349 |
| Molecular Formula | C20H14F6 |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 6-(4-butyl-2,6-difluorophenyl)-1,2,3,8-tetrafluoronaphthalene |
| SMILES | CCCCc1cc(F)c(-c2cc(F)c3c(F)c(F)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C20H14F6/c1-2-3-4-10-5-13(21)17(14(22)6-10)11-7-12-9-16(24)19(25)20(26)18(12)15(23)8-11/h5-9H,2-4H2,1H3 |
| InChIKey | FORALRRYLGONEO-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|