C26H19F5 — CID 139847281
6-[4-(4-butyl-2-fluorophenyl)-2-fluorophenyl]-1,2,3-trifluoronaphthalene (PubChem CID 139847281) has the molecular formula C26H19F5 and a molecular weight of 426.43 g/mol. Its IUPAC name is 6-[4-(4-butyl-2-fluorophenyl)-2-fluorophenyl]-1,2,3-trifluoronaphthalene.
| Compound Name | 6-[4-(4-butyl-2-fluorophenyl)-2-fluorophenyl]-1,2,3-trifluoronaphthalene |
|---|---|
| PubChem CID | 139847281 |
| Molecular Formula | C26H19F5 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 6-[4-(4-butyl-2-fluorophenyl)-2-fluorophenyl]-1,2,3-trifluoronaphthalene |
| SMILES | CCCCc1ccc(-c2ccc(-c3ccc4c(F)c(F)c(F)cc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C26H19F5/c1-2-3-4-15-5-8-19(22(27)11-15)17-6-9-20(23(28)13-17)16-7-10-21-18(12-16)14-24(29)26(31)25(21)30/h5-14H,2-4H2,1H3 |
| InChIKey | IFJIRLDDEYWGHP-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|