C24H14F6 — CID 139847159
6-[4-(4-ethyl-2,6-difluorophenyl)-2-fluorophenyl]-1,2,3-trifluoronaphthalene (PubChem CID 139847159) has the molecular formula C24H14F6 and a molecular weight of 416.36 g/mol. Its IUPAC name is 6-[4-(4-ethyl-2,6-difluorophenyl)-2-fluorophenyl]-1,2,3-trifluoronaphthalene.
| Compound Name | 6-[4-(4-ethyl-2,6-difluorophenyl)-2-fluorophenyl]-1,2,3-trifluoronaphthalene |
|---|---|
| PubChem CID | 139847159 |
| Molecular Formula | C24H14F6 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 6-[4-(4-ethyl-2,6-difluorophenyl)-2-fluorophenyl]-1,2,3-trifluoronaphthalene |
| SMILES | CCc1cc(F)c(-c2ccc(-c3ccc4c(F)c(F)c(F)cc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C24H14F6/c1-2-12-7-19(26)22(20(27)8-12)14-4-5-16(18(25)10-14)13-3-6-17-15(9-13)11-21(28)24(30)23(17)29/h3-11H,2H2,1H3 |
| InChIKey | OJQSLIHOLYUUMH-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|