C18H13F3 — CID 139846935
6-(4-ethyl-2-fluorophenyl)-2,3-difluoronaphthalene (PubChem CID 139846935) has the molecular formula C18H13F3 and a molecular weight of 286.30 g/mol. Its IUPAC name is 6-(4-ethyl-2-fluorophenyl)-2,3-difluoronaphthalene.
| Compound Name | 6-(4-ethyl-2-fluorophenyl)-2,3-difluoronaphthalene |
|---|---|
| PubChem CID | 139846935 |
| Molecular Formula | C18H13F3 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 6-(4-ethyl-2-fluorophenyl)-2,3-difluoronaphthalene |
| SMILES | CCc1ccc(-c2ccc3cc(F)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C18H13F3/c1-2-11-3-6-15(16(19)7-11)13-5-4-12-9-17(20)18(21)10-14(12)8-13/h3-10H,2H2,1H3 |
| InChIKey | AETUZXYLZSFVBF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |