C17H11F3 — CID 139847087
2,3-difluoro-6-(2-fluoro-4-methylphenyl)naphthalene (PubChem CID 139847087) has the molecular formula C17H11F3 and a molecular weight of 272.27 g/mol. Its IUPAC name is 2,3-difluoro-6-(2-fluoro-4-methylphenyl)naphthalene.
| Compound Name | 2,3-difluoro-6-(2-fluoro-4-methylphenyl)naphthalene |
|---|---|
| PubChem CID | 139847087 |
| Molecular Formula | C17H11F3 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2,3-difluoro-6-(2-fluoro-4-methylphenyl)naphthalene |
| SMILES | Cc1ccc(-c2ccc3cc(F)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C17H11F3/c1-10-2-5-14(15(18)6-10)12-4-3-11-8-16(19)17(20)9-13(11)7-12/h2-9H,1H3 |
| InChIKey | MFBACZMTZCIESR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |