C26H16F4 — CID 139846670
6-[2-[4-(4-ethyl-2-fluorophenyl)-2-fluorophenyl]ethynyl]-2,3-difluoronaphthalene (PubChem CID 139846670) has the molecular formula C26H16F4 and a molecular weight of 404.41 g/mol. Its IUPAC name is 6-[2-[4-(4-ethyl-2-fluorophenyl)-2-fluorophenyl]ethynyl]-2,3-difluoronaphthalene.
| Compound Name | 6-[2-[4-(4-ethyl-2-fluorophenyl)-2-fluorophenyl]ethynyl]-2,3-difluoronaphthalene |
|---|---|
| PubChem CID | 139846670 |
| Molecular Formula | C26H16F4 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 6-[2-[4-(4-ethyl-2-fluorophenyl)-2-fluorophenyl]ethynyl]-2,3-difluoronaphthalene |
| SMILES | CCc1ccc(-c2ccc(C#Cc3ccc4cc(F)c(F)cc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C26H16F4/c1-2-16-5-10-22(24(28)12-16)20-9-8-18(23(27)14-20)6-3-17-4-7-19-13-25(29)26(30)15-21(19)11-17/h4-5,7-15H,2H2,1H3 |
| InChIKey | GMGQRNHROBSCQE-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|