C27H16F6 — CID 139846620
1,2,3,8-tetrafluoro-6-[2-[2-fluoro-4-(2-fluoro-4-propylphenyl)phenyl]ethynyl]naphthalene (PubChem CID 139846620) has the molecular formula C27H16F6 and a molecular weight of 454.41 g/mol. Its IUPAC name is 1,2,3,8-tetrafluoro-6-[2-[2-fluoro-4-(2-fluoro-4-propylphenyl)phenyl]ethynyl]naphthalene.
| Compound Name | 1,2,3,8-tetrafluoro-6-[2-[2-fluoro-4-(2-fluoro-4-propylphenyl)phenyl]ethynyl]naphthalene |
|---|---|
| PubChem CID | 139846620 |
| Molecular Formula | C27H16F6 |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 1,2,3,8-tetrafluoro-6-[2-[2-fluoro-4-(2-fluoro-4-propylphenyl)phenyl]ethynyl]naphthalene |
| SMILES | CCCc1ccc(-c2ccc(C#Cc3cc(F)c4c(F)c(F)c(F)cc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C27H16F6/c1-2-3-15-5-9-20(22(29)11-15)18-8-7-17(21(28)13-18)6-4-16-10-19-14-24(31)26(32)27(33)25(19)23(30)12-16/h5,7-14H,2-3H2,1H3 |
| InChIKey | QABOSSDXYIHAEG-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|