C25H19F2N — CID 171752218
4-[2-[4-(4-butyl-2-fluorophenyl)-2-fluorophenyl]ethynyl]benzonitrile (PubChem CID 171752218) has the molecular formula C25H19F2N and a molecular weight of 371.43 g/mol. Its IUPAC name is 4-[2-[4-(4-butyl-2-fluorophenyl)-2-fluorophenyl]ethynyl]benzonitrile.
| Compound Name | 4-[2-[4-(4-butyl-2-fluorophenyl)-2-fluorophenyl]ethynyl]benzonitrile |
|---|---|
| PubChem CID | 171752218 |
| Molecular Formula | C25H19F2N |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 4-[2-[4-(4-butyl-2-fluorophenyl)-2-fluorophenyl]ethynyl]benzonitrile |
| SMILES | CCCCc1ccc(-c2ccc(C#Cc3ccc(C#N)cc3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C25H19F2N/c1-2-3-4-19-10-14-23(25(27)15-19)22-13-12-21(24(26)16-22)11-9-18-5-7-20(17-28)8-6-18/h5-8,10,12-16H,2-4H2,1H3 |
| InChIKey | SCJQPUGKXRKERU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|