C24H21F2N — CID 90209321
2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]benzonitrile (PubChem CID 90209321) has the molecular formula C24H21F2N and a molecular weight of 361.44 g/mol. Its IUPAC name is 2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]benzonitrile.
| Compound Name | 2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 90209321 |
| Molecular Formula | C24H21F2N |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]benzonitrile |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc(C#N)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C24H21F2N/c1-2-3-4-5-17-6-8-18(9-7-17)19-12-13-22(24(26)14-19)20-10-11-21(16-27)23(25)15-20/h6-15H,2-5H2,1H3 |
| InChIKey | CJODWRQCWNMHRV-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|