C23H23F2N — CID 142281352
2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]aniline (PubChem CID 142281352) has the molecular formula C23H23F2N and a molecular weight of 351.44 g/mol. Its IUPAC name is 2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]aniline.
| Compound Name | 2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 142281352 |
| Molecular Formula | C23H23F2N |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]aniline |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc(N)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C23H23F2N/c1-2-3-4-5-16-6-8-17(9-7-16)18-10-12-20(21(24)14-18)19-11-13-23(26)22(25)15-19/h6-15H,2-5,26H2,1H3 |
| InChIKey | TWZSMLIYKPWRKT-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|