C23H21F3O — CID 139457352
2,6-difluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenol (PubChem CID 139457352) has the molecular formula C23H21F3O and a molecular weight of 370.41 g/mol. Its IUPAC name is 2,6-difluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenol.
| Compound Name | 2,6-difluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenol |
|---|---|
| PubChem CID | 139457352 |
| Molecular Formula | C23H21F3O |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2,6-difluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenol |
| SMILES | CCCCCc1ccc(-c2ccc(-c3cc(F)c(O)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C23H21F3O/c1-2-3-4-5-15-6-8-16(9-7-15)17-10-11-19(20(24)12-17)18-13-21(25)23(27)22(26)14-18/h6-14,27H,2-5H2,1H3 |
| InChIKey | OXSBAEYXTBNIIU-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|