About 2-fluoro-4-pentylaniline
2-fluoro-4-pentylaniline (PubChem CID 146198864) has the molecular formula C11H16FN
and a molecular weight of 181.25 g/mol. Its IUPAC name is 2-fluoro-4-pentylaniline.
Molecular Properties
| Compound Name | 2-fluoro-4-pentylaniline |
| PubChem CID | 146198864 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 2-fluoro-4-pentylaniline |
| SMILES | CCCCCc1ccc(N)c(F)c1 |
| InChI | InChI=1S/C11H16FN/c1-2-3-4-5-9-6-7-11(13)10(12)8-9/h6-8H,2-5,13H2,1H3 |
| InChIKey | YAGRIXFVNURJMP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-4-pentylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-pentylaniline?
The IUPAC name of 2-fluoro-4-pentylaniline (CID 146198864) is 2-fluoro-4-pentylaniline.
What is the SMILES notation for 2-fluoro-4-pentylaniline?
The canonical SMILES for 2-fluoro-4-pentylaniline is CCCCCc1ccc(N)c(F)c1.
What is the InChIKey of 2-fluoro-4-pentylaniline?
The InChIKey is YAGRIXFVNURJMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16FN/c1-2-3-4-5-9-6-7-11(13)10(12)8-9/h6-8H,2-5,13H2,1H3.
What are the key properties of 2-fluoro-4-pentylaniline?
2-fluoro-4-pentylaniline has a molecular weight of 181.25 g/mol, XLogP of 3.14, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-pentylaniline is sourced from PubChem (CID 146198864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).