About 4-hexyl-2-methoxyaniline
4-hexyl-2-methoxyaniline (PubChem CID 70551686) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is 4-hexyl-2-methoxyaniline.
Molecular Properties
| Compound Name | 4-hexyl-2-methoxyaniline |
| PubChem CID | 70551686 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 4-hexyl-2-methoxyaniline |
| SMILES | CCCCCCc1ccc(N)c(OC)c1 |
| InChI | InChI=1S/C13H21NO/c1-3-4-5-6-7-11-8-9-12(14)13(10-11)15-2/h8-10H,3-7,14H2,1-2H3 |
| InChIKey | BSZIBMRZACCKDX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-hexyl-2-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexyl-2-methoxyaniline?
The IUPAC name of 4-hexyl-2-methoxyaniline (CID 70551686) is 4-hexyl-2-methoxyaniline.
What is the SMILES notation for 4-hexyl-2-methoxyaniline?
The canonical SMILES for 4-hexyl-2-methoxyaniline is CCCCCCc1ccc(N)c(OC)c1.
What is the InChIKey of 4-hexyl-2-methoxyaniline?
The InChIKey is BSZIBMRZACCKDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO/c1-3-4-5-6-7-11-8-9-12(14)13(10-11)15-2/h8-10H,3-7,14H2,1-2H3.
What are the key properties of 4-hexyl-2-methoxyaniline?
4-hexyl-2-methoxyaniline has a molecular weight of 207.32 g/mol, XLogP of 3.40, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexyl-2-methoxyaniline is sourced from PubChem (CID 70551686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).